C27H26O7 — CID 70847112
[(9R,10S)-15-hydroxy-7,13-dimethoxy-10-(4-methoxyphenyl)-5-methyl-2-oxo-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl] acetate (PubChem CID 70847112) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is [(9R,10S)-15-hydroxy-7,13-dimethoxy-10-(4-methoxyphenyl)-5-methyl-2-oxo-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl] acetate.
| Compound Name | [(9R,10S)-15-hydroxy-7,13-dimethoxy-10-(4-methoxyphenyl)-5-methyl-2-oxo-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl] acetate |
|---|---|
| PubChem CID | 70847112 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(9R,10S)-15-hydroxy-7,13-dimethoxy-10-(4-methoxyphenyl)-5-methyl-2-oxo-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl] acetate |
| SMILES | COc1ccc([C@H]2c3cc(OC)cc(O)c3C(=O)c3cc(C)cc(OC)c3[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C27H26O7/c1-14-10-20-25(22(11-14)33-5)27(34-15(2)28)23(16-6-8-17(31-3)9-7-16)19-12-18(32-4)13-21(29)24(19)26(20)30/h6-13,23,27,29H,1-5H3/t23-,27+/m0/s1 |
| InChIKey | WWJWIDDZMHPUNG-WNCULLNHSA-N |
| XLogP | 4.71 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |