C10H14N2S — CID 7084759
2,2-dimethyl-3,4-dihydro-1,4-benzothiazin-6-amine (PubChem CID 7084759) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 2,2-dimethyl-3,4-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 7084759 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydro-1,4-benzothiazin-6-amine |
| SMILES | CC1(C)CNc2cc(N)ccc2S1 |
| InChI | InChI=1S/C10H14N2S/c1-10(2)6-12-8-5-7(11)3-4-9(8)13-10/h3-5,12H,6,11H2,1-2H3 |
| InChIKey | VAEKSNCACFJICM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|