C61H39N7 — CID 70847685
2-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine (PubChem CID 70847685) has the molecular formula C61H39N7 and a molecular weight of 870.03 g/mol. Its IUPAC name is 2-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 70847685 |
| Molecular Formula | C61H39N7 |
| Molecular Weight | 870.03 g/mol |
| Exact Mass | 869.33 |
| IUPAC Name | 2-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-c4nc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C61H39N7/c1-5-19-42(20-6-1)53-38-55(64-57(62-53)44-23-9-3-10-24-44)50-35-51(56-39-54(43-21-7-2-8-22-43)63-58(65-56)45-25-11-4-12-26-45)37-52(36-50)61-67-59(48-31-29-40-17-13-15-27-46(40)33-48)66-60(68-61)49-32-30-41-18-14-16-28-47(41)34-49/h1-39H |
| InChIKey | APONBONGVPTJRF-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.03 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |