C19H38N4O3 — CID 70847711
1,3-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 70847711) has the molecular formula C19H38N4O3 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1,3-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1,3-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 70847711 |
| Molecular Formula | C19H38N4O3 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 1,3-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC1(C)CC(NC(=O)NC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C19H38N4O3/c1-16(2)9-13(10-17(3,4)22(16)25)20-15(24)21-14-11-18(5,6)23(26)19(7,8)12-14/h13-14,25-26H,9-12H2,1-8H3,(H2,20,21,24) |
| InChIKey | KHMIWPPSFNLUHX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |