C14H27NO4 — CID 70848320
tert-butyl 4-(2-hydroxy-2-methylpropoxy)piperidine-1-carboxylate (PubChem CID 70848320) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is tert-butyl 4-(2-hydroxy-2-methylpropoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-hydroxy-2-methylpropoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70848320 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | tert-butyl 4-(2-hydroxy-2-methylpropoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(O)COC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27NO4/c1-13(2,3)19-12(16)15-8-6-11(7-9-15)18-10-14(4,5)17/h11,17H,6-10H2,1-5H3 |
| InChIKey | VQMHZSLAYAMTQG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |