C14H25N5O2 — CID 70848374
tert-butyl N-ethyl-N-[2-(2-methyl-2-pyrimidin-2-ylhydrazinyl)ethyl]carbamate (PubChem CID 70848374) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-(2-methyl-2-pyrimidin-2-ylhydrazinyl)ethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-(2-methyl-2-pyrimidin-2-ylhydrazinyl)ethyl]carbamate |
|---|---|
| PubChem CID | 70848374 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-(2-methyl-2-pyrimidin-2-ylhydrazinyl)ethyl]carbamate |
| SMILES | CCN(CCNN(C)c1ncccn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N5O2/c1-6-19(13(20)21-14(2,3)4)11-10-17-18(5)12-15-8-7-9-16-12/h7-9,17H,6,10-11H2,1-5H3 |
| InChIKey | KXQRLDFERGWPOI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|