About tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate
tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate (PubChem CID 70848420) has the molecular formula C14H22N2O3S
and a molecular weight of 298.41 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate |
| PubChem CID | 70848420 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate |
| SMILES | CC(=O)c1cnc([C@H](NC(=O)OC(C)(C)C)C(C)C)s1 |
| InChI | InChI=1S/C14H22N2O3S/c1-8(2)11(16-13(18)19-14(4,5)6)12-15-7-10(20-12)9(3)17/h7-8,11H,1-6H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | WNLRGSOMWVKDCH-LLVKDONJSA-N |
| XLogP | 3.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
The IUPAC name of tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate (CID 70848420) is tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
The canonical SMILES for tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate is CC(=O)c1cnc([C@H](NC(=O)OC(C)(C)C)C(C)C)s1.
What is the InChIKey of tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
The InChIKey is WNLRGSOMWVKDCH-LLVKDONJSA-N. The full InChI is InChI=1S/C14H22N2O3S/c1-8(2)11(16-13(18)19-14(4,5)6)12-15-7-10(20-12)9(3)17/h7-8,11H,1-6H3,(H,16,18)/t11-/m1/s1.
What are the key properties of tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate?
tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate has a molecular weight of 298.41 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R)-1-(5-acetyl-1,3-thiazol-2-yl)-2-methylpropyl]carbamate is sourced from PubChem (CID 70848420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).