C31H46O4 — CID 70848513
(Z,5R)-7-[2-(cyclohexa-1,5-dien-1-ylmethoxy)ethyl]-1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]-5-propylnon-7-ene-1,6-dione (PubChem CID 70848513) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is (Z,5R)-7-[2-(cyclohexa-1,5-dien-1-ylmethoxy)ethyl]-1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]-5-propylnon-7-ene-1,6-dione.
| Compound Name | (Z,5R)-7-[2-(cyclohexa-1,5-dien-1-ylmethoxy)ethyl]-1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]-5-propylnon-7-ene-1,6-dione |
|---|---|
| PubChem CID | 70848513 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | (Z,5R)-7-[2-(cyclohexa-1,5-dien-1-ylmethoxy)ethyl]-1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]-5-propylnon-7-ene-1,6-dione |
| SMILES | C/C=C(/CCOCC1=CCCC=C1)C(=O)[C@H](CCC)CCCC(=O)C1=CCC(OC(C)(C)C)C=C1 |
| InChI | InChI=1S/C31H46O4/c1-6-12-27(30(33)25(7-2)21-22-34-23-24-13-9-8-10-14-24)15-11-16-29(32)26-17-19-28(20-18-26)35-31(3,4)5/h7,9,13-14,17-19,27-28H,6,8,10-12,15-16,20-23H2,1-5H3/b25-7-/t27-,28?/m1/s1 |
| InChIKey | NTLUGNIPXIPYSI-YWNAPXDPSA-N |
| XLogP | 7.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|