C26H30O6S3 — CID 70848995
5,7-bis[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)butan-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 70848995) has the molecular formula C26H30O6S3 and a molecular weight of 534.72 g/mol. Its IUPAC name is 5,7-bis[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)butan-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-bis[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)butan-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 70848995 |
| Molecular Formula | C26H30O6S3 |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 5,7-bis[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)butan-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCC(C)(c1scc2c1OCCO2)c1sc(C(C)(CC)c2scc3c2OCCO3)c2c1OCCO2 |
| InChI | InChI=1S/C26H30O6S3/c1-5-25(3,21-17-15(13-33-21)27-7-9-29-17)23-19-20(32-12-11-31-19)24(35-23)26(4,6-2)22-18-16(14-34-22)28-8-10-30-18/h13-14H,5-12H2,1-4H3 |
| InChIKey | CAGIDAPSMMEMSI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |