C12H21NO2 — CID 70849437
1,2-diethyl-7-methyl-2,3,3a,4,7,7a-hexahydropyrano[3,4-b]pyrrol-5-one (PubChem CID 70849437) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1,2-diethyl-7-methyl-2,3,3a,4,7,7a-hexahydropyrano[3,4-b]pyrrol-5-one.
| Compound Name | 1,2-diethyl-7-methyl-2,3,3a,4,7,7a-hexahydropyrano[3,4-b]pyrrol-5-one |
|---|---|
| PubChem CID | 70849437 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1,2-diethyl-7-methyl-2,3,3a,4,7,7a-hexahydropyrano[3,4-b]pyrrol-5-one |
| SMILES | CCC1CC2CC(=O)OC(C)C2N1CC |
| InChI | InChI=1S/C12H21NO2/c1-4-10-6-9-7-11(14)15-8(3)12(9)13(10)5-2/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | KDGKXLOPWNBNNJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |