C16H17F3N6 — CID 70849529
(4R)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)piperidin-3-amine (PubChem CID 70849529) has the molecular formula C16H17F3N6 and a molecular weight of 350.35 g/mol. Its IUPAC name is (4R)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)piperidin-3-amine.
| Compound Name | (4R)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 70849529 |
| Molecular Formula | C16H17F3N6 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (4R)-1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)piperidin-3-amine |
| SMILES | NC1CN(c2ccc3nncn3n2)CC[C@@H]1C1CC(F)=C(F)C=C1F |
| InChI | InChI=1S/C16H17F3N6/c17-11-6-13(19)12(18)5-10(11)9-3-4-24(7-14(9)20)16-2-1-15-22-21-8-25(15)23-16/h1-2,6,8-10,14H,3-5,7,20H2/t9-,10?,14?/m1/s1 |
| InChIKey | KGOQMZUNBRKWLL-NAUIOFCNSA-N |
| XLogP | 2.30 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |