About 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine
9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine (PubChem CID 70849666) has the molecular formula C15H20N4O2
and a molecular weight of 288.35 g/mol. Its IUPAC name is 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine.
Molecular Properties
| Compound Name | 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine |
| PubChem CID | 70849666 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine |
| SMILES | CCCCOc1cc2c(cc1OC)-c1nnnn1CCC2 |
| InChI | InChI=1S/C15H20N4O2/c1-3-4-8-21-14-9-11-6-5-7-19-15(16-17-18-19)12(11)10-13(14)20-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | VIVDRBDHIBJJAV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine?
The IUPAC name of 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine (CID 70849666) is 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine.
What is the SMILES notation for 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine?
The canonical SMILES for 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine is CCCCOc1cc2c(cc1OC)-c1nnnn1CCC2.
What is the InChIKey of 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine?
The InChIKey is VIVDRBDHIBJJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2/c1-3-4-8-21-14-9-11-6-5-7-19-15(16-17-18-19)12(11)10-13(14)20-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine?
9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine has a molecular weight of 288.35 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butoxy-10-methoxy-6,7-dihydro-5H-tetrazolo[5,1-a][2]benzazepine is sourced from PubChem (CID 70849666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).