C18H29N — CID 70849952
5-ethyl-1-(3-ethylcyclohexyl)-2,3,5,6-tetrahydroindole (PubChem CID 70849952) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 5-ethyl-1-(3-ethylcyclohexyl)-2,3,5,6-tetrahydroindole.
| Compound Name | 5-ethyl-1-(3-ethylcyclohexyl)-2,3,5,6-tetrahydroindole |
|---|---|
| PubChem CID | 70849952 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 5-ethyl-1-(3-ethylcyclohexyl)-2,3,5,6-tetrahydroindole |
| SMILES | CCC1C=C2CCN(C3CCCC(CC)C3)C2=CC1 |
| InChI | InChI=1S/C18H29N/c1-3-14-6-5-7-17(13-14)19-11-10-16-12-15(4-2)8-9-18(16)19/h9,12,14-15,17H,3-8,10-11,13H2,1-2H3 |
| InChIKey | NMEFUMKODDVNBN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |