C16H12N2O2 — CID 70850186
2,19-dioxa-9,12-diazapentacyclo[10.7.1.03,8.09,20.013,18]icosa-3,5,7,10,13,15,17-heptaene (PubChem CID 70850186) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2,19-dioxa-9,12-diazapentacyclo[10.7.1.03,8.09,20.013,18]icosa-3,5,7,10,13,15,17-heptaene.
| Compound Name | 2,19-dioxa-9,12-diazapentacyclo[10.7.1.03,8.09,20.013,18]icosa-3,5,7,10,13,15,17-heptaene |
|---|---|
| PubChem CID | 70850186 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2,19-dioxa-9,12-diazapentacyclo[10.7.1.03,8.09,20.013,18]icosa-3,5,7,10,13,15,17-heptaene |
| SMILES | C1=CN2c3ccccc3OC3Oc4ccccc4N1C32 |
| InChI | InChI=1S/C16H12N2O2/c1-3-7-13-11(5-1)17-9-10-18-12-6-2-4-8-14(12)20-16(19-13)15(17)18/h1-10,15-16H |
| InChIKey | NBLRJQNSUAJGFP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |