C35H52B2O8 — CID 70850351
2-[9,9-bis[2-(2-methoxyethoxy)ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 70850351) has the molecular formula C35H52B2O8 and a molecular weight of 622.42 g/mol. Its IUPAC name is 2-[9,9-bis[2-(2-methoxyethoxy)ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,9-bis[2-(2-methoxyethoxy)ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 70850351 |
| Molecular Formula | C35H52B2O8 |
| Molecular Weight | 622.42 g/mol |
| Exact Mass | 622.38 |
| IUPAC Name | 2-[9,9-bis[2-(2-methoxyethoxy)ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COCCOCCC1(CCOCCOC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C35H52B2O8/c1-31(2)32(3,4)43-36(42-31)25-11-13-27-28-14-12-26(37-44-33(5,6)34(7,8)45-37)24-30(28)35(29(27)23-25,15-17-40-21-19-38-9)16-18-41-22-20-39-10/h11-14,23-24H,15-22H2,1-10H3 |
| InChIKey | MCRJVPLOMDUQLX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|