About 1-butan-2-yl-4-chloro-2,3-dihydroindole
1-butan-2-yl-4-chloro-2,3-dihydroindole (PubChem CID 70850462) has the molecular formula C12H16ClN
and a molecular weight of 209.72 g/mol. Its IUPAC name is 1-butan-2-yl-4-chloro-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-butan-2-yl-4-chloro-2,3-dihydroindole |
| PubChem CID | 70850462 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-butan-2-yl-4-chloro-2,3-dihydroindole |
| SMILES | CCC(C)N1CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C12H16ClN/c1-3-9(2)14-8-7-10-11(13)5-4-6-12(10)14/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | PKBVURCIFBHXME-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butan-2-yl-4-chloro-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-4-chloro-2,3-dihydroindole?
The IUPAC name of 1-butan-2-yl-4-chloro-2,3-dihydroindole (CID 70850462) is 1-butan-2-yl-4-chloro-2,3-dihydroindole.
What is the SMILES notation for 1-butan-2-yl-4-chloro-2,3-dihydroindole?
The canonical SMILES for 1-butan-2-yl-4-chloro-2,3-dihydroindole is CCC(C)N1CCc2c(Cl)cccc21.
What is the InChIKey of 1-butan-2-yl-4-chloro-2,3-dihydroindole?
The InChIKey is PKBVURCIFBHXME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClN/c1-3-9(2)14-8-7-10-11(13)5-4-6-12(10)14/h4-6,9H,3,7-8H2,1-2H3.
What are the key properties of 1-butan-2-yl-4-chloro-2,3-dihydroindole?
1-butan-2-yl-4-chloro-2,3-dihydroindole has a molecular weight of 209.72 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-4-chloro-2,3-dihydroindole is sourced from PubChem (CID 70850462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).