About [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite
[(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite (PubChem CID 70850531) has the molecular formula C8H18NO4P
and a molecular weight of 223.21 g/mol. Its IUPAC name is [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite.
Molecular Properties
| Compound Name | [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite |
| PubChem CID | 70850531 |
| Molecular Formula | C8H18NO4P |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite |
| SMILES | CC1CC([C@@H](N)C[C@H](O)OP(O)O)C1 |
| InChI | InChI=1S/C8H18NO4P/c1-5-2-6(3-5)7(9)4-8(10)13-14(11)12/h5-8,10-12H,2-4,9H2,1H3/t5?,6?,7-,8+/m0/s1 |
| InChIKey | ZQRWUXKUUFDKBF-RLXKETGRSA-N |
| XLogP | 0.30 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite?
The IUPAC name of [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite (CID 70850531) is [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite.
What is the SMILES notation for [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite?
The canonical SMILES for [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite is CC1CC([C@@H](N)C[C@H](O)OP(O)O)C1.
What is the InChIKey of [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite?
The InChIKey is ZQRWUXKUUFDKBF-RLXKETGRSA-N. The full InChI is InChI=1S/C8H18NO4P/c1-5-2-6(3-5)7(9)4-8(10)13-14(11)12/h5-8,10-12H,2-4,9H2,1H3/t5?,6?,7-,8+/m0/s1.
What are the key properties of [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite?
[(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite has a molecular weight of 223.21 g/mol, XLogP of 0.30, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-amino-1-hydroxy-3-(3-methylcyclobutyl)propyl] dihydrogen phosphite is sourced from PubChem (CID 70850531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).