C17H13ClFN3O2 — CID 70851046
N-(4-chloro-3-fluorophenyl)-2-(3-methyl-4-oxophthalazin-1-yl)acetamide (PubChem CID 70851046) has the molecular formula C17H13ClFN3O2 and a molecular weight of 345.76 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-2-(3-methyl-4-oxophthalazin-1-yl)acetamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 70851046 |
| Molecular Formula | C17H13ClFN3O2 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-2-(3-methyl-4-oxophthalazin-1-yl)acetamide |
| SMILES | Cn1nc(CC(=O)Nc2ccc(Cl)c(F)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C17H13ClFN3O2/c1-22-17(24)12-5-3-2-4-11(12)15(21-22)9-16(23)20-10-6-7-13(18)14(19)8-10/h2-8H,9H2,1H3,(H,20,23) |
| InChIKey | INMIPHZIAWGHGE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |