About 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one
1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one (PubChem CID 70852632) has the molecular formula C9H14N2O5
and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one |
| PubChem CID | 70852632 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one |
| SMILES | O=c1ccn([C@@H](OCCO)C(O)CO)cn1 |
| InChI | InChI=1S/C9H14N2O5/c12-3-4-16-9(7(14)5-13)11-2-1-8(15)10-6-11/h1-2,6-7,9,12-14H,3-5H2/t7?,9-/m0/s1 |
| InChIKey | KPRXQAAWYZJSFK-NETXQHHPSA-N |
| XLogP | -1.90 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one?
The IUPAC name of 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one (CID 70852632) is 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one.
What is the SMILES notation for 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one?
The canonical SMILES for 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one is O=c1ccn([C@@H](OCCO)C(O)CO)cn1.
What is the InChIKey of 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one?
The InChIKey is KPRXQAAWYZJSFK-NETXQHHPSA-N. The full InChI is InChI=1S/C9H14N2O5/c12-3-4-16-9(7(14)5-13)11-2-1-8(15)10-6-11/h1-2,6-7,9,12-14H,3-5H2/t7?,9-/m0/s1.
What are the key properties of 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one?
1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one has a molecular weight of 230.22 g/mol, XLogP of -1.90, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-2,3-dihydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-4-one is sourced from PubChem (CID 70852632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).