About 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one
6-bromo-2,3,4,9-tetrahydrocarbazol-1-one (PubChem CID 708529) has the molecular formula C12H10BrNO
and a molecular weight of 264.12 g/mol. Its IUPAC name is 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one.
Molecular Properties
| Compound Name | 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one |
| PubChem CID | 708529 |
| Molecular Formula | C12H10BrNO |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one |
| SMILES | O=C1CCCc2c1[nH]c1ccc(Br)cc21 |
| InChI | InChI=1S/C12H10BrNO/c13-7-4-5-10-9(6-7)8-2-1-3-11(15)12(8)14-10/h4-6,14H,1-3H2 |
| InChIKey | UZMYPCOHBHVFJE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one?
The IUPAC name of 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one (CID 708529) is 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one.
What is the SMILES notation for 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one?
The canonical SMILES for 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one is O=C1CCCc2c1[nH]c1ccc(Br)cc21.
What is the InChIKey of 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one?
The InChIKey is UZMYPCOHBHVFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNO/c13-7-4-5-10-9(6-7)8-2-1-3-11(15)12(8)14-10/h4-6,14H,1-3H2.
What are the key properties of 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one?
6-bromo-2,3,4,9-tetrahydrocarbazol-1-one has a molecular weight of 264.12 g/mol, XLogP of 3.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3,4,9-tetrahydrocarbazol-1-one is sourced from PubChem (CID 708529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).