C26H23F3N4O — CID 70853157
6-morpholin-4-yl-N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyridin-2-amine (PubChem CID 70853157) has the molecular formula C26H23F3N4O and a molecular weight of 464.49 g/mol. Its IUPAC name is 6-morpholin-4-yl-N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyridin-2-amine.
| Compound Name | 6-morpholin-4-yl-N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 70853157 |
| Molecular Formula | C26H23F3N4O |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 6-morpholin-4-yl-N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyridin-2-amine |
| SMILES | FC(F)(F)c1cccc(-c2cccc3ccc(CNc4cccc(N5CCOCC5)n4)nc23)c1 |
| InChI | InChI=1S/C26H23F3N4O/c27-26(28,29)20-6-1-5-19(16-20)22-7-2-4-18-10-11-21(31-25(18)22)17-30-23-8-3-9-24(32-23)33-12-14-34-15-13-33/h1-11,16H,12-15,17H2,(H,30,32) |
| InChIKey | ZIXHVRAJOXROCA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |