C26H23NO5S — CID 70853349
4-O-benzyl 3-O-(9H-fluoren-9-ylmethyl) (4R)-oxathiazinane-3,4-dicarboxylate (PubChem CID 70853349) has the molecular formula C26H23NO5S and a molecular weight of 461.54 g/mol. Its IUPAC name is 4-O-benzyl 3-O-(9H-fluoren-9-ylmethyl) (4R)-oxathiazinane-3,4-dicarboxylate.
| Compound Name | 4-O-benzyl 3-O-(9H-fluoren-9-ylmethyl) (4R)-oxathiazinane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 70853349 |
| Molecular Formula | C26H23NO5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 4-O-benzyl 3-O-(9H-fluoren-9-ylmethyl) (4R)-oxathiazinane-3,4-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CCOSN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H23NO5S/c28-25(30-16-18-8-2-1-3-9-18)24-14-15-32-33-27(24)26(29)31-17-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,23-24H,14-17H2/t24-/m1/s1 |
| InChIKey | HEGKLBYMODNYTI-XMMPIXPASA-N |
| XLogP | 5.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|