C11H22N2O2 — CID 70853374
(3aR,6aS)-3a,6a-bis(methoxymethyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 70853374) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (3aR,6aS)-3a,6a-bis(methoxymethyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-3a,6a-bis(methoxymethyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 70853374 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (3aR,6aS)-3a,6a-bis(methoxymethyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | COC[C@]12CNC[C@@]1(COC)CN(C)C2 |
| InChI | InChI=1S/C11H22N2O2/c1-13-6-10(8-14-2)4-12-5-11(10,7-13)9-15-3/h12H,4-9H2,1-3H3/t10-,11+ |
| InChIKey | QQYSRSIIIRXSAQ-PHIMTYICSA-N |
| XLogP | -0.20 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |