C34H45ClN4O2 — CID 70853439
6-chloro-N-[2-[[(2S)-1-[ethyl-[(2S)-2-phenylbutyl]amino]-1-oxo-4-piperidin-1-ylbutan-2-yl]amino]ethyl]naphthalene-2-carboxamide (PubChem CID 70853439) has the molecular formula C34H45ClN4O2 and a molecular weight of 577.21 g/mol. Its IUPAC name is 6-chloro-N-[2-[[(2S)-1-[ethyl-[(2S)-2-phenylbutyl]amino]-1-oxo-4-piperidin-1-ylbutan-2-yl]amino]ethyl]naphthalene-2-carboxamide.
| Compound Name | 6-chloro-N-[2-[[(2S)-1-[ethyl-[(2S)-2-phenylbutyl]amino]-1-oxo-4-piperidin-1-ylbutan-2-yl]amino]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70853439 |
| Molecular Formula | C34H45ClN4O2 |
| Molecular Weight | 577.21 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | 6-chloro-N-[2-[[(2S)-1-[ethyl-[(2S)-2-phenylbutyl]amino]-1-oxo-4-piperidin-1-ylbutan-2-yl]amino]ethyl]naphthalene-2-carboxamide |
| SMILES | CC[C@H](CN(CC)C(=O)[C@H](CCN1CCCCC1)NCCNC(=O)c1ccc2cc(Cl)ccc2c1)c1ccccc1 |
| InChI | InChI=1S/C34H45ClN4O2/c1-3-26(27-11-7-5-8-12-27)25-39(4-2)34(41)32(17-22-38-20-9-6-10-21-38)36-18-19-37-33(40)30-14-13-29-24-31(35)16-15-28(29)23-30/h5,7-8,11-16,23-24,26,32,36H,3-4,6,9-10,17-22,25H2,1-2H3,(H,37,40)/t26-,32+/m1/s1 |
| InChIKey | PWPOMAAAWANOIS-DICHSLLOSA-N |
| XLogP | 6.10 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.21 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|