C13H13NO2 — CID 708536
7-methoxy-2,3,4,9-tetrahydrocarbazol-1-one (PubChem CID 708536) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 7-methoxy-2,3,4,9-tetrahydrocarbazol-1-one.
| Compound Name | 7-methoxy-2,3,4,9-tetrahydrocarbazol-1-one |
|---|---|
| PubChem CID | 708536 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 7-methoxy-2,3,4,9-tetrahydrocarbazol-1-one |
| SMILES | COc1ccc2c3c([nH]c2c1)C(=O)CCC3 |
| InChI | InChI=1S/C13H13NO2/c1-16-8-5-6-9-10-3-2-4-12(15)13(10)14-11(9)7-8/h5-7,14H,2-4H2,1H3 |
| InChIKey | KVUQFLZVUWYPGW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|