About (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol
(1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol (PubChem CID 70853857) has the molecular formula C12H12F2N2O
and a molecular weight of 238.24 g/mol. Its IUPAC name is (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol |
| PubChem CID | 70853857 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol |
| SMILES | Cc1cc(F)c(F)cc1-c1[nH]ncc1[C@H](C)O |
| InChI | InChI=1S/C12H12F2N2O/c1-6-3-10(13)11(14)4-8(6)12-9(7(2)17)5-15-16-12/h3-5,7,17H,1-2H3,(H,15,16)/t7-/m0/s1 |
| InChIKey | IPZCYXOGEQARCF-ZETCQYMHSA-N |
| XLogP | 2.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol?
The IUPAC name of (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol (CID 70853857) is (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol.
What is the SMILES notation for (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol?
The canonical SMILES for (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol is Cc1cc(F)c(F)cc1-c1[nH]ncc1[C@H](C)O.
What is the InChIKey of (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol?
The InChIKey is IPZCYXOGEQARCF-ZETCQYMHSA-N. The full InChI is InChI=1S/C12H12F2N2O/c1-6-3-10(13)11(14)4-8(6)12-9(7(2)17)5-15-16-12/h3-5,7,17H,1-2H3,(H,15,16)/t7-/m0/s1.
What are the key properties of (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol?
(1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol has a molecular weight of 238.24 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[5-(4,5-difluoro-2-methylphenyl)-1H-pyrazol-4-yl]ethanol is sourced from PubChem (CID 70853857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).