C23H15FN4O2 — CID 70854303
methyl 4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)benzoate (PubChem CID 70854303) has the molecular formula C23H15FN4O2 and a molecular weight of 398.40 g/mol. Its IUPAC name is methyl 4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)benzoate.
| Compound Name | methyl 4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)benzoate |
|---|---|
| PubChem CID | 70854303 |
| Molecular Formula | C23H15FN4O2 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | methyl 4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2c(F)cnc3[nH]c4cnc(-c5cccnc5)cc4c23)cc1 |
| InChI | InChI=1S/C23H15FN4O2/c1-30-23(29)14-6-4-13(5-7-14)20-17(24)11-27-22-21(20)16-9-18(26-12-19(16)28-22)15-3-2-8-25-10-15/h2-12H,1H3,(H,27,28) |
| InChIKey | GGUDYECMJIQUOG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |