C29H26N4O4 — CID 70854902
7-[4-[3-[(4-methoxyphenyl)methoxy]phenoxy]phenyl]-3-methyl-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine (PubChem CID 70854902) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 7-[4-[3-[(4-methoxyphenyl)methoxy]phenoxy]phenyl]-3-methyl-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine.
| Compound Name | 7-[4-[3-[(4-methoxyphenyl)methoxy]phenoxy]phenyl]-3-methyl-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine |
|---|---|
| PubChem CID | 70854902 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 7-[4-[3-[(4-methoxyphenyl)methoxy]phenoxy]phenyl]-3-methyl-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-9-amine |
| SMILES | COc1ccc(COc2cccc(Oc3ccc(-n4c5c(c6ncnc(N)c64)C(C)OC5)cc3)c2)cc1 |
| InChI | InChI=1S/C29H26N4O4/c1-18-26-25(16-35-18)33(28-27(26)31-17-32-29(28)30)20-8-12-22(13-9-20)37-24-5-3-4-23(14-24)36-15-19-6-10-21(34-2)11-7-19/h3-14,17-18H,15-16H2,1-2H3,(H2,30,31,32) |
| InChIKey | UWVIUEQGZDYZMU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |