C22H23N3OS — CID 7085596
(1R)-1-(4-methoxyphenyl)-N-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 7085596) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is (1R)-1-(4-methoxyphenyl)-N-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | (1R)-1-(4-methoxyphenyl)-N-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 7085596 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (1R)-1-(4-methoxyphenyl)-N-(4-methylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | COc1ccc([C@@H]2c3cccn3CCN2C(=S)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H23N3OS/c1-16-5-9-18(10-6-16)23-22(27)25-15-14-24-13-3-4-20(24)21(25)17-7-11-19(26-2)12-8-17/h3-13,21H,14-15H2,1-2H3,(H,23,27)/t21-/m1/s1 |
| InChIKey | YSAOCEKAYBAPBU-OAQYLSRUSA-N |
| XLogP | 4.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|