C14H21N5O2 — CID 70856439
4-N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]pyrimidine-2,4-diamine (PubChem CID 70856439) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 70856439 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 4-N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)ncc1OCc1c(C)noc1C |
| InChI | InChI=1S/C14H21N5O2/c1-4-5-6-16-13-12(7-17-14(15)18-13)20-8-11-9(2)19-21-10(11)3/h7H,4-6,8H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | AHTWZMABCRCKCL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|