C17H8N10 — CID 70856637
5-amino-11,16-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,10,17-tricarbonitrile (PubChem CID 70856637) has the molecular formula C17H8N10 and a molecular weight of 352.32 g/mol. Its IUPAC name is 5-amino-11,16-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,10,17-tricarbonitrile.
| Compound Name | 5-amino-11,16-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,10,17-tricarbonitrile |
|---|---|
| PubChem CID | 70856637 |
| Molecular Formula | C17H8N10 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 5-amino-11,16-dimethyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,4,6,8,10,12,14,16-nonaene-4,10,17-tricarbonitrile |
| SMILES | Cc1nc2c3nc(C)c(C#N)nc3c3nc(C#N)c(N)nc3c2nc1C#N |
| InChI | InChI=1S/C17H8N10/c1-6-8(3-18)24-13-11(22-6)12-14(25-9(4-19)7(2)23-12)16-15(13)26-10(5-20)17(21)27-16/h1-2H3,(H2,21,27) |
| InChIKey | QCQUULUSAPMASF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|