About (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide
(E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide (PubChem CID 70856678) has the molecular formula C9H12F3NO
and a molecular weight of 207.19 g/mol. Its IUPAC name is (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide.
Molecular Properties
| Compound Name | (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide |
| PubChem CID | 70856678 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide |
| SMILES | CCNC(=O)/C=C(\C1CC1)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO/c1-2-13-8(14)5-7(6-3-4-6)9(10,11)12/h5-6H,2-4H2,1H3,(H,13,14)/b7-5+ |
| InChIKey | SBVMTKMFHSMJTQ-FNORWQNLSA-N |
| XLogP | 2.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide?
The IUPAC name of (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide (CID 70856678) is (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide.
What is the SMILES notation for (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide?
The canonical SMILES for (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide is CCNC(=O)/C=C(\C1CC1)C(F)(F)F.
What is the InChIKey of (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide?
The InChIKey is SBVMTKMFHSMJTQ-FNORWQNLSA-N. The full InChI is InChI=1S/C9H12F3NO/c1-2-13-8(14)5-7(6-3-4-6)9(10,11)12/h5-6H,2-4H2,1H3,(H,13,14)/b7-5+.
What are the key properties of (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide?
(E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide has a molecular weight of 207.19 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-cyclopropyl-N-ethyl-4,4,4-trifluorobut-2-enamide is sourced from PubChem (CID 70856678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).