C20H24N2 — CID 70856818
2,3-di(cyclohexa-1,3-dien-1-yl)-7-methyl-1,2,6,7-tetrahydrobenzimidazole (PubChem CID 70856818) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2,3-di(cyclohexa-1,3-dien-1-yl)-7-methyl-1,2,6,7-tetrahydrobenzimidazole.
| Compound Name | 2,3-di(cyclohexa-1,3-dien-1-yl)-7-methyl-1,2,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 70856818 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2,3-di(cyclohexa-1,3-dien-1-yl)-7-methyl-1,2,6,7-tetrahydrobenzimidazole |
| SMILES | CC1CC=CC2=C1NC(C1=CC=CCC1)N2C1=CC=CCC1 |
| InChI | InChI=1S/C20H24N2/c1-15-9-8-14-18-19(15)21-20(16-10-4-2-5-11-16)22(18)17-12-6-3-7-13-17/h2-4,6,8,10,12,14-15,20-21H,5,7,9,11,13H2,1H3 |
| InChIKey | VNRPPTDCVIDFEY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |