C15H22N2 — CID 70856834
2-cyclohexa-1,3-dien-1-yl-3,5-dimethyl-1,2,3a,6,7,7a-hexahydrobenzimidazole (PubChem CID 70856834) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-3,5-dimethyl-1,2,3a,6,7,7a-hexahydrobenzimidazole.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-3,5-dimethyl-1,2,3a,6,7,7a-hexahydrobenzimidazole |
|---|---|
| PubChem CID | 70856834 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-3,5-dimethyl-1,2,3a,6,7,7a-hexahydrobenzimidazole |
| SMILES | CC1=CC2C(CC1)NC(C1=CC=CCC1)N2C |
| InChI | InChI=1S/C15H22N2/c1-11-8-9-13-14(10-11)17(2)15(16-13)12-6-4-3-5-7-12/h3-4,6,10,13-16H,5,7-9H2,1-2H3 |
| InChIKey | JGOFNVVNLYCETF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|