C14H20N2 — CID 70856849
2-cyclohexa-1,3-dien-1-yl-3-methyl-1,2,4,5,6,7-hexahydrobenzimidazole (PubChem CID 70856849) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-3-methyl-1,2,4,5,6,7-hexahydrobenzimidazole.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-3-methyl-1,2,4,5,6,7-hexahydrobenzimidazole |
|---|---|
| PubChem CID | 70856849 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-3-methyl-1,2,4,5,6,7-hexahydrobenzimidazole |
| SMILES | CN1C2=C(CCCC2)NC1C1=CC=CCC1 |
| InChI | InChI=1S/C14H20N2/c1-16-13-10-6-5-9-12(13)15-14(16)11-7-3-2-4-8-11/h2-3,7,14-15H,4-6,8-10H2,1H3 |
| InChIKey | KMLCLDPHBAIQOR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |