C20H28N2 — CID 70856851
2-cyclohexa-1,5-dien-1-yl-1-cyclohex-3-en-1-yl-5-methyl-3a,4,5,6,7,7a-hexahydrobenzimidazole (PubChem CID 70856851) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-1-cyclohex-3-en-1-yl-5-methyl-3a,4,5,6,7,7a-hexahydrobenzimidazole.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-1-cyclohex-3-en-1-yl-5-methyl-3a,4,5,6,7,7a-hexahydrobenzimidazole |
|---|---|
| PubChem CID | 70856851 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-1-cyclohex-3-en-1-yl-5-methyl-3a,4,5,6,7,7a-hexahydrobenzimidazole |
| SMILES | CC1CCC2C(C1)N=C(C1=CCCC=C1)N2C1CC=CCC1 |
| InChI | InChI=1S/C20H28N2/c1-15-12-13-19-18(14-15)21-20(16-8-4-2-5-9-16)22(19)17-10-6-3-7-11-17/h3-4,6,8-9,15,17-19H,2,5,7,10-14H2,1H3 |
| InChIKey | ATCRXRBVNYIOJC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|