About 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol
4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol (PubChem CID 70857252) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol |
| PubChem CID | 70857252 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol |
| SMILES | COCC1=C(O)C(COC)CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C14H24O3/c1-14(2,3)12-6-10(8-16-4)13(15)11(7-12)9-17-5/h6,11,15H,7-9H2,1-5H3 |
| InChIKey | SDVWJBALTPBCLY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol?
The IUPAC name of 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol (CID 70857252) is 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol?
The canonical SMILES for 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol is COCC1=C(O)C(COC)CC(C(C)(C)C)=C1.
What is the InChIKey of 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol?
The InChIKey is SDVWJBALTPBCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-14(2,3)12-6-10(8-16-4)13(15)11(7-12)9-17-5/h6,11,15H,7-9H2,1-5H3.
What are the key properties of 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol?
4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol has a molecular weight of 240.34 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-bis(methoxymethyl)cyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 70857252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).