C29H56N2O9 — CID 70858376
cis-(3R,11S)-11-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10,13-tetrahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 70858376) has the molecular formula C29H56N2O9 and a molecular weight of 576.77 g/mol. Its IUPAC name is cis-(3R,11S)-11-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10,13-tetrahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | cis-(3R,11S)-11-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10,13-tetrahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 70858376 |
| Molecular Formula | C29H56N2O9 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | cis-(3R,11S)-11-[(2S)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10,13-tetrahydroxy-3,5,8,10,12,14-hexamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CCC1OC(=O)C(C)C(O)C(C)[C@H](O[C@@H]2OC(C)CC(N(C)C)C2O)C(C)(O)CC(C)CNC(C)C(O)[C@@]1(C)O |
| InChI | InChI=1S/C29H56N2O9/c1-11-21-29(8,37)24(34)19(6)30-14-15(2)13-28(7,36)25(17(4)22(32)18(5)26(35)39-21)40-27-23(33)20(31(9)10)12-16(3)38-27/h15-25,27,30,32-34,36-37H,11-14H2,1-10H3/t15?,16?,17?,18?,19?,20?,21?,22?,23?,24?,25-,27-,28?,29-/m0/s1 |
| InChIKey | LOMZTTMTKSVHAG-VSGSRDHESA-N |
| XLogP | 0.63 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |