C16H26N3P — CID 70858492
[4-ethyl-4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)cyclohexen-1-yl]phosphane (PubChem CID 70858492) has the molecular formula C16H26N3P and a molecular weight of 291.38 g/mol. Its IUPAC name is [4-ethyl-4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)cyclohexen-1-yl]phosphane.
| Compound Name | [4-ethyl-4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)cyclohexen-1-yl]phosphane |
|---|---|
| PubChem CID | 70858492 |
| Molecular Formula | C16H26N3P |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | [4-ethyl-4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)cyclohexen-1-yl]phosphane |
| SMILES | CCC1(c2nnc3n2CCCCCC3)CC=C(P)CC1 |
| InChI | InChI=1S/C16H26N3P/c1-2-16(10-8-13(20)9-11-16)15-18-17-14-7-5-3-4-6-12-19(14)15/h8H,2-7,9-12,20H2,1H3 |
| InChIKey | DLVBAPPIWLEHFI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|