C20H31N3 — CID 70858493
3,4-dicyclopropyl-5-(1-methyl-4-pentylcyclohex-3-en-1-yl)-1,2,4-triazole (PubChem CID 70858493) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 3,4-dicyclopropyl-5-(1-methyl-4-pentylcyclohex-3-en-1-yl)-1,2,4-triazole.
| Compound Name | 3,4-dicyclopropyl-5-(1-methyl-4-pentylcyclohex-3-en-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 70858493 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 3,4-dicyclopropyl-5-(1-methyl-4-pentylcyclohex-3-en-1-yl)-1,2,4-triazole |
| SMILES | CCCCCC1=CCC(C)(c2nnc(C3CC3)n2C2CC2)CC1 |
| InChI | InChI=1S/C20H31N3/c1-3-4-5-6-15-11-13-20(2,14-12-15)19-22-21-18(16-7-8-16)23(19)17-9-10-17/h11,16-17H,3-10,12-14H2,1-2H3 |
| InChIKey | JFUXXFNCHNSABC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|