C15H20O4 — CID 70859664
(1'R,3'aR,8'aS,9'aS)-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one (PubChem CID 70859664) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1'R,3'aR,8'aS,9'aS)-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one.
| Compound Name | (1'R,3'aR,8'aS,9'aS)-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
|---|---|
| PubChem CID | 70859664 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1'R,3'aR,8'aS,9'aS)-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
| SMILES | C[C@H]1OC(=O)[C@@H]2C=C3CC4(CC[C@H]3C[C@H]12)OCCO4 |
| InChI | InChI=1S/C15H20O4/c1-9-12-6-10-2-3-15(17-4-5-18-15)8-11(10)7-13(12)14(16)19-9/h7,9-10,12-13H,2-6,8H2,1H3/t9-,10+,12-,13-/m1/s1 |
| InChIKey | SERADVFMOYPMCQ-LYIQGSDWSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|