About 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one (PubChem CID 70859726) has the molecular formula C18H24N8OS
and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one |
| PubChem CID | 70859726 |
| Molecular Formula | C18H24N8OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one |
| SMILES | CCn1c(N2CCNCC2)nc2nc(Sc3nc(C)cc(C)n3)n(C)c(=O)c21 |
| InChI | InChI=1S/C18H24N8OS/c1-5-26-13-14(22-17(26)25-8-6-19-7-9-25)23-18(24(4)15(13)27)28-16-20-11(2)10-12(3)21-16/h10,19H,5-9H2,1-4H3 |
| InChIKey | DWRSAHCQXQHIJL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one (CID 70859726) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one is CCn1c(N2CCNCC2)nc2nc(Sc3nc(C)cc(C)n3)n(C)c(=O)c21.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one?
The InChIKey is DWRSAHCQXQHIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N8OS/c1-5-26-13-14(22-17(26)25-8-6-19-7-9-25)23-18(24(4)15(13)27)28-16-20-11(2)10-12(3)21-16/h10,19H,5-9H2,1-4H3.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one?
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one has a molecular weight of 400.51 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-7-ethyl-1-methyl-8-piperazin-1-ylpurin-6-one is sourced from PubChem (CID 70859726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).