C16H18ClNO6 — CID 70859752
5-chloro-2-[(2R,5S)-4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]isoindole-1,3-dione (PubChem CID 70859752) has the molecular formula C16H18ClNO6 and a molecular weight of 355.77 g/mol. Its IUPAC name is 5-chloro-2-[(2R,5S)-4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]isoindole-1,3-dione.
| Compound Name | 5-chloro-2-[(2R,5S)-4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70859752 |
| Molecular Formula | C16H18ClNO6 |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 5-chloro-2-[(2R,5S)-4-hydroxy-6-(hydroxymethyl)-2-methoxy-5-methyloxan-3-yl]isoindole-1,3-dione |
| SMILES | CO[C@@H]1OC(CO)[C@@H](C)C(O)C1N1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C16H18ClNO6/c1-7-11(6-19)24-16(23-2)12(13(7)20)18-14(21)9-4-3-8(17)5-10(9)15(18)22/h3-5,7,11-13,16,19-20H,6H2,1-2H3/t7-,11?,12?,13?,16-/m1/s1 |
| InChIKey | RRHANWNJTPQFOS-OVHWTTFFSA-N |
| XLogP | 0.67 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|