C19H14N6OS — CID 70860667
6-(12-amino-5-methoxy-9,11,13-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-17-yl)-1H-pyrimidine-2-thione (PubChem CID 70860667) has the molecular formula C19H14N6OS and a molecular weight of 374.43 g/mol. Its IUPAC name is 6-(12-amino-5-methoxy-9,11,13-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-17-yl)-1H-pyrimidine-2-thione.
| Compound Name | 6-(12-amino-5-methoxy-9,11,13-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-17-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 70860667 |
| Molecular Formula | C19H14N6OS |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 6-(12-amino-5-methoxy-9,11,13-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaen-17-yl)-1H-pyrimidine-2-thione |
| SMILES | COc1ccc2nc3c(cc2c1)c(-c1ccnc(=S)[nH]1)c1ccnc(N)n13 |
| InChI | InChI=1S/C19H14N6OS/c1-26-11-2-3-13-10(8-11)9-12-16(14-4-6-22-19(27)24-14)15-5-7-21-18(20)25(15)17(12)23-13/h2-9H,1H3,(H2,20,21)(H,22,24,27) |
| InChIKey | XZQRVIZSIQNAJO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|