C17H22FN3O3S — CID 70861089
(5R,7S,8Z)-5-amino-19-fluoro-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one (PubChem CID 70861089) has the molecular formula C17H22FN3O3S and a molecular weight of 367.45 g/mol. Its IUPAC name is (5R,7S,8Z)-5-amino-19-fluoro-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one.
| Compound Name | (5R,7S,8Z)-5-amino-19-fluoro-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one |
|---|---|
| PubChem CID | 70861089 |
| Molecular Formula | C17H22FN3O3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (5R,7S,8Z)-5-amino-19-fluoro-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one |
| SMILES | N[C@]12C[C@H]1/C=C\CCCCCNc1ccc(F)cc1S(=O)(=O)NC2=O |
| InChI | InChI=1S/C17H22FN3O3S/c18-13-7-8-14-15(10-13)25(23,24)21-16(22)17(19)11-12(17)6-4-2-1-3-5-9-20-14/h4,6-8,10,12,20H,1-3,5,9,11,19H2,(H,21,22)/b6-4-/t12-,17-/m1/s1 |
| InChIKey | JJDDCZLDMGEEAS-IFVOFZGESA-N |
| XLogP | 1.89 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|