C18H33FO4 — CID 70861298
(3R,6R)-3,4-dibutoxy-2-(butoxymethyl)-6-fluoro-3,6-dihydro-2H-pyran (PubChem CID 70861298) has the molecular formula C18H33FO4 and a molecular weight of 332.46 g/mol. Its IUPAC name is (3R,6R)-3,4-dibutoxy-2-(butoxymethyl)-6-fluoro-3,6-dihydro-2H-pyran.
| Compound Name | (3R,6R)-3,4-dibutoxy-2-(butoxymethyl)-6-fluoro-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 70861298 |
| Molecular Formula | C18H33FO4 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (3R,6R)-3,4-dibutoxy-2-(butoxymethyl)-6-fluoro-3,6-dihydro-2H-pyran |
| SMILES | CCCCOCC1O[C@H](F)C=C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C18H33FO4/c1-4-7-10-20-14-16-18(22-12-9-6-3)15(13-17(19)23-16)21-11-8-5-2/h13,16-18H,4-12,14H2,1-3H3/t16?,17-,18-/m0/s1 |
| InChIKey | PTTSZOYIAHBZBU-FQECFTEESA-N |
| XLogP | 4.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|