C23H25F3N4O2 — CID 70862564
2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-N-(6-tetracyclo[4.3.1.01,8.02,4]decanylmethyl)imidazo[1,2-a]pyridine-5-carboxamide (PubChem CID 70862564) has the molecular formula C23H25F3N4O2 and a molecular weight of 446.47 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-N-(6-tetracyclo[4.3.1.01,8.02,4]decanylmethyl)imidazo[1,2-a]pyridine-5-carboxamide.
| Compound Name | 2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-N-(6-tetracyclo[4.3.1.01,8.02,4]decanylmethyl)imidazo[1,2-a]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 70862564 |
| Molecular Formula | C23H25F3N4O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-N-(6-tetracyclo[4.3.1.01,8.02,4]decanylmethyl)imidazo[1,2-a]pyridine-5-carboxamide |
| SMILES | O=C(Cc1cn2c(C(=O)NCC34CC5CC5C5(CC5C3)C4)cccc2n1)NCC(F)(F)F |
| InChI | InChI=1S/C23H25F3N4O2/c24-23(25,26)12-27-19(31)5-15-9-30-17(2-1-3-18(30)29-15)20(32)28-11-21-6-13-4-16(13)22(10-21)8-14(22)7-21/h1-3,9,13-14,16H,4-8,10-12H2,(H,27,31)(H,28,32) |
| InChIKey | BSYYKFPTCFNKDQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |