C33H37Cl2N3O2S — CID 70862720
3-(2,4-dichlorophenyl)-10-(2-methoxyphenyl)-N-(3,4,4-trimethyl-2-propylpentyl)-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxamide (PubChem CID 70862720) has the molecular formula C33H37Cl2N3O2S and a molecular weight of 610.65 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-10-(2-methoxyphenyl)-N-(3,4,4-trimethyl-2-propylpentyl)-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-10-(2-methoxyphenyl)-N-(3,4,4-trimethyl-2-propylpentyl)-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 70862720 |
| Molecular Formula | C33H37Cl2N3O2S |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-10-(2-methoxyphenyl)-N-(3,4,4-trimethyl-2-propylpentyl)-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxamide |
| SMILES | CCCC(CNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c2c1Cc1cc(-c3ccccc3OC)sc1-2)C(C)C(C)(C)C |
| InChI | InChI=1S/C33H37Cl2N3O2S/c1-7-10-20(19(2)33(3,4)5)18-36-32(39)29-24-15-21-16-28(23-11-8-9-12-27(23)40-6)41-31(21)30(24)38(37-29)26-14-13-22(34)17-25(26)35/h8-9,11-14,16-17,19-20H,7,10,15,18H2,1-6H3,(H,36,39) |
| InChIKey | LCFWNJRXTOBRRA-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |