C30H35Cl2N3O2 — CID 70863284
(4,6-dichloro-1H-indol-2-yl)-[4-[1-hydroxy-2-[(3S,3'S)-3'-methylspiro[3a,4-dihydroindene-3,4'-piperidine]-1'-yl]ethyl]piperidin-1-yl]methanone (PubChem CID 70863284) has the molecular formula C30H35Cl2N3O2 and a molecular weight of 540.54 g/mol. Its IUPAC name is (4,6-dichloro-1H-indol-2-yl)-[4-[1-hydroxy-2-[(3S,3'S)-3'-methylspiro[3a,4-dihydroindene-3,4'-piperidine]-1'-yl]ethyl]piperidin-1-yl]methanone.
| Compound Name | (4,6-dichloro-1H-indol-2-yl)-[4-[1-hydroxy-2-[(3S,3'S)-3'-methylspiro[3a,4-dihydroindene-3,4'-piperidine]-1'-yl]ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70863284 |
| Molecular Formula | C30H35Cl2N3O2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (4,6-dichloro-1H-indol-2-yl)-[4-[1-hydroxy-2-[(3S,3'S)-3'-methylspiro[3a,4-dihydroindene-3,4'-piperidine]-1'-yl]ethyl]piperidin-1-yl]methanone |
| SMILES | C[C@@H]1CN(CC(O)C2CCN(C(=O)c3cc4c(Cl)cc(Cl)cc4[nH]3)CC2)CC[C@@]12C=CC1=CC=CCC12 |
| InChI | InChI=1S/C30H35Cl2N3O2/c1-19-17-34(13-10-30(19)9-6-20-4-2-3-5-24(20)30)18-28(36)21-7-11-35(12-8-21)29(37)27-16-23-25(32)14-22(31)15-26(23)33-27/h2-4,6,9,14-16,19,21,24,28,33,36H,5,7-8,10-13,17-18H2,1H3/t19-,24?,28?,30+/m1/s1 |
| InChIKey | MTWYCAUGRXBIGE-QALUVYSDSA-N |
| XLogP | 6.09 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |