C31H41N5O5 — CID 70863428
(5S,8S)-7-N-tert-butyl-8-N-[(6E)-3,4,12-trioxo-2,13-diazabicyclo[12.4.0]octadeca-1(18),6,14,16-tetraen-5-yl]-7-azadispiro[3.0.45.14]decane-7,8-dicarboxamide (PubChem CID 70863428) has the molecular formula C31H41N5O5 and a molecular weight of 563.70 g/mol. Its IUPAC name is (5S,8S)-7-N-tert-butyl-8-N-[(6E)-3,4,12-trioxo-2,13-diazabicyclo[12.4.0]octadeca-1(18),6,14,16-tetraen-5-yl]-7-azadispiro[3.0.45.14]decane-7,8-dicarboxamide.
| Compound Name | (5S,8S)-7-N-tert-butyl-8-N-[(6E)-3,4,12-trioxo-2,13-diazabicyclo[12.4.0]octadeca-1(18),6,14,16-tetraen-5-yl]-7-azadispiro[3.0.45.14]decane-7,8-dicarboxamide |
|---|---|
| PubChem CID | 70863428 |
| Molecular Formula | C31H41N5O5 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | (5S,8S)-7-N-tert-butyl-8-N-[(6E)-3,4,12-trioxo-2,13-diazabicyclo[12.4.0]octadeca-1(18),6,14,16-tetraen-5-yl]-7-azadispiro[3.0.45.14]decane-7,8-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)N1C[C@]2(C[C@H]1C(=O)NC1/C=C/CCCCC(=O)Nc3ccccc3NC(=O)C1=O)CC21CCC1 |
| InChI | InChI=1S/C31H41N5O5/c1-29(2,3)35-28(41)36-19-31(18-30(31)15-10-16-30)17-23(36)26(39)34-22-13-6-4-5-7-14-24(37)32-20-11-8-9-12-21(20)33-27(40)25(22)38/h6,8-9,11-13,22-23H,4-5,7,10,14-19H2,1-3H3,(H,32,37)(H,33,40)(H,34,39)(H,35,41)/b13-6+/t22?,23-,31-/m0/s1 |
| InChIKey | NPXPRCPOGILGQL-GVUWDHDSSA-N |
| XLogP | 3.89 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|